C21H32F3NO — CID 153345852
methylcyclobutane;2-[3-methyl-4-(pentan-2-ylideneamino)-5-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 153345852) has the molecular formula C21H32F3NO and a molecular weight of 371.49 g/mol. Its IUPAC name is methylcyclobutane;2-[3-methyl-4-(pentan-2-ylideneamino)-5-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | methylcyclobutane;2-[3-methyl-4-(pentan-2-ylideneamino)-5-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 153345852 |
| Molecular Formula | C21H32F3NO |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | methylcyclobutane;2-[3-methyl-4-(pentan-2-ylideneamino)-5-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | CC1CCC1.CCC/C(C)=N/c1c(C)cc(C(C)(C)O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H22F3NO.C5H10/c1-6-7-11(3)20-14-10(2)8-12(15(4,5)21)9-13(14)16(17,18)19;1-5-3-2-4-5/h8-9,21H,6-7H2,1-5H3;5H,2-4H2,1H3/b20-11+; |
| InChIKey | XPJWSTVUJPEZSW-DOELHFPHSA-N |
| XLogP | 6.94 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|