C8HCl2F4N3 — CID 154644376
4,7-dichloro-8-fluoro-2-(trifluoromethyl)pyrido[4,3-d]pyrimidine (PubChem CID 154644376) has the molecular formula C8HCl2F4N3 and a molecular weight of 286.02 g/mol. Its IUPAC name is 4,7-dichloro-8-fluoro-2-(trifluoromethyl)pyrido[4,3-d]pyrimidine.
| Compound Name | 4,7-dichloro-8-fluoro-2-(trifluoromethyl)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 154644376 |
| Molecular Formula | C8HCl2F4N3 |
| Molecular Weight | 286.02 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | 4,7-dichloro-8-fluoro-2-(trifluoromethyl)pyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(Cl)ncc2c(Cl)nc(C(F)(F)F)nc12 |
| InChI | InChI=1S/C8HCl2F4N3/c9-5-2-1-15-6(10)3(11)4(2)16-7(17-5)8(12,13)14/h1H |
| InChIKey | UYFRJIQQPCKCAO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.02 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|