C12H11ClF2N3O5P — CID 154650000
1-[3-chloro-5-[(2,4-difluorophenyl)carbamoyl]pyrazol-1-yl]ethyl dihydrogen phosphate (PubChem CID 154650000) has the molecular formula C12H11ClF2N3O5P and a molecular weight of 381.66 g/mol. Its IUPAC name is 1-[3-chloro-5-[(2,4-difluorophenyl)carbamoyl]pyrazol-1-yl]ethyl dihydrogen phosphate.
| Compound Name | 1-[3-chloro-5-[(2,4-difluorophenyl)carbamoyl]pyrazol-1-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 154650000 |
| Molecular Formula | C12H11ClF2N3O5P |
| Molecular Weight | 381.66 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 1-[3-chloro-5-[(2,4-difluorophenyl)carbamoyl]pyrazol-1-yl]ethyl dihydrogen phosphate |
| SMILES | CC(OP(=O)(O)O)n1nc(Cl)cc1C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C12H11ClF2N3O5P/c1-6(23-24(20,21)22)18-10(5-11(13)17-18)12(19)16-9-3-2-7(14)4-8(9)15/h2-6H,1H3,(H,16,19)(H2,20,21,22) |
| InChIKey | OJHYYQDCTXOAHP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|