C9H6ClF2N4O4P — CID 154649889
[4-chloro-5-[(2,4-difluorophenyl)carbamoyl]triazol-2-yl]phosphonic acid (PubChem CID 154649889) has the molecular formula C9H6ClF2N4O4P and a molecular weight of 338.59 g/mol. Its IUPAC name is [4-chloro-5-[(2,4-difluorophenyl)carbamoyl]triazol-2-yl]phosphonic acid.
| Compound Name | [4-chloro-5-[(2,4-difluorophenyl)carbamoyl]triazol-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 154649889 |
| Molecular Formula | C9H6ClF2N4O4P |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | [4-chloro-5-[(2,4-difluorophenyl)carbamoyl]triazol-2-yl]phosphonic acid |
| SMILES | O=C(Nc1ccc(F)cc1F)c1nn(P(=O)(O)O)nc1Cl |
| InChI | InChI=1S/C9H6ClF2N4O4P/c10-8-7(14-16(15-8)21(18,19)20)9(17)13-6-2-1-4(11)3-5(6)12/h1-3H,(H,13,17)(H2,18,19,20) |
| InChIKey | LBFOUTYLLQHUKT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|