C10H9F2N4O5P — CID 154650017
[4-[(2,4-difluorophenyl)carbamoyl]triazol-2-yl]methyl dihydrogen phosphate (PubChem CID 154650017) has the molecular formula C10H9F2N4O5P and a molecular weight of 334.18 g/mol. Its IUPAC name is [4-[(2,4-difluorophenyl)carbamoyl]triazol-2-yl]methyl dihydrogen phosphate.
| Compound Name | [4-[(2,4-difluorophenyl)carbamoyl]triazol-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 154650017 |
| Molecular Formula | C10H9F2N4O5P |
| Molecular Weight | 334.18 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [4-[(2,4-difluorophenyl)carbamoyl]triazol-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cnn(COP(=O)(O)O)n1 |
| InChI | InChI=1S/C10H9F2N4O5P/c11-6-1-2-8(7(12)3-6)14-10(17)9-4-13-16(15-9)5-21-22(18,19)20/h1-4H,5H2,(H,14,17)(H2,18,19,20) |
| InChIKey | UVCFKBOYCRCXDN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|