C11H11ClFN4O5P — CID 159197037
[4-[(2-chloro-4-methylphenyl)carbamoyl]-5-fluorotriazol-2-yl]methyl dihydrogen phosphate (PubChem CID 159197037) has the molecular formula C11H11ClFN4O5P and a molecular weight of 364.66 g/mol. Its IUPAC name is [4-[(2-chloro-4-methylphenyl)carbamoyl]-5-fluorotriazol-2-yl]methyl dihydrogen phosphate.
| Compound Name | [4-[(2-chloro-4-methylphenyl)carbamoyl]-5-fluorotriazol-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 159197037 |
| Molecular Formula | C11H11ClFN4O5P |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | [4-[(2-chloro-4-methylphenyl)carbamoyl]-5-fluorotriazol-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1ccc(NC(=O)c2nn(COP(=O)(O)O)nc2F)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClFN4O5P/c1-6-2-3-8(7(12)4-6)14-11(18)9-10(13)16-17(15-9)5-22-23(19,20)21/h2-4H,5H2,1H3,(H,14,18)(H2,19,20,21) |
| InChIKey | YSSGGVPKIVQDLH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|