C12H13Cl2N4O5P — CID 161268046
1-[4-chloro-5-[(2-chloro-4-methylphenyl)carbamoyl]triazol-2-yl]ethyl dihydrogen phosphate (PubChem CID 161268046) has the molecular formula C12H13Cl2N4O5P and a molecular weight of 395.14 g/mol. Its IUPAC name is 1-[4-chloro-5-[(2-chloro-4-methylphenyl)carbamoyl]triazol-2-yl]ethyl dihydrogen phosphate.
| Compound Name | 1-[4-chloro-5-[(2-chloro-4-methylphenyl)carbamoyl]triazol-2-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 161268046 |
| Molecular Formula | C12H13Cl2N4O5P |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 1-[4-chloro-5-[(2-chloro-4-methylphenyl)carbamoyl]triazol-2-yl]ethyl dihydrogen phosphate |
| SMILES | Cc1ccc(NC(=O)c2nn(C(C)OP(=O)(O)O)nc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N4O5P/c1-6-3-4-9(8(13)5-6)15-12(19)10-11(14)17-18(16-10)7(2)23-24(20,21)22/h3-5,7H,1-2H3,(H,15,19)(H2,20,21,22) |
| InChIKey | MZNDJXQNEYIYRE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|