C12H10Cl4N3O5P — CID 154649992
1-[3,4-dichloro-5-[(2,4-dichlorophenyl)carbamoyl]pyrazol-1-yl]ethyl dihydrogen phosphate (PubChem CID 154649992) has the molecular formula C12H10Cl4N3O5P and a molecular weight of 449.01 g/mol. Its IUPAC name is 1-[3,4-dichloro-5-[(2,4-dichlorophenyl)carbamoyl]pyrazol-1-yl]ethyl dihydrogen phosphate.
| Compound Name | 1-[3,4-dichloro-5-[(2,4-dichlorophenyl)carbamoyl]pyrazol-1-yl]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 154649992 |
| Molecular Formula | C12H10Cl4N3O5P |
| Molecular Weight | 449.01 g/mol |
| Exact Mass | 446.91 |
| IUPAC Name | 1-[3,4-dichloro-5-[(2,4-dichlorophenyl)carbamoyl]pyrazol-1-yl]ethyl dihydrogen phosphate |
| SMILES | CC(OP(=O)(O)O)n1nc(Cl)c(Cl)c1C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl4N3O5P/c1-5(24-25(21,22)23)19-10(9(15)11(16)18-19)12(20)17-8-3-2-6(13)4-7(8)14/h2-5H,1H3,(H,17,20)(H2,21,22,23) |
| InChIKey | YPLDECJSNHSCBJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.01 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|