C10H9ClFN4O4P — CID 160904980
[4-[(2-chloro-4-methylphenyl)carbamoyl]-5-fluorotriazol-2-yl]phosphonic acid (PubChem CID 160904980) has the molecular formula C10H9ClFN4O4P and a molecular weight of 334.63 g/mol. Its IUPAC name is [4-[(2-chloro-4-methylphenyl)carbamoyl]-5-fluorotriazol-2-yl]phosphonic acid.
| Compound Name | [4-[(2-chloro-4-methylphenyl)carbamoyl]-5-fluorotriazol-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 160904980 |
| Molecular Formula | C10H9ClFN4O4P |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | [4-[(2-chloro-4-methylphenyl)carbamoyl]-5-fluorotriazol-2-yl]phosphonic acid |
| SMILES | Cc1ccc(NC(=O)c2nn(P(=O)(O)O)nc2F)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClFN4O4P/c1-5-2-3-7(6(11)4-5)13-10(17)8-9(12)15-16(14-8)21(18,19)20/h2-4H,1H3,(H,13,17)(H2,18,19,20) |
| InChIKey | AOSUKAJOVUWIHG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|