C11H11BrClN4O4P — CID 170083159
[4-bromo-5-[(2-chloro-4-methylphenyl)carbamoyl]triazol-2-yl]methylphosphonic acid (PubChem CID 170083159) has the molecular formula C11H11BrClN4O4P and a molecular weight of 409.56 g/mol. Its IUPAC name is [4-bromo-5-[(2-chloro-4-methylphenyl)carbamoyl]triazol-2-yl]methylphosphonic acid.
| Compound Name | [4-bromo-5-[(2-chloro-4-methylphenyl)carbamoyl]triazol-2-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 170083159 |
| Molecular Formula | C11H11BrClN4O4P |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | [4-bromo-5-[(2-chloro-4-methylphenyl)carbamoyl]triazol-2-yl]methylphosphonic acid |
| SMILES | Cc1ccc(NC(=O)c2nn(CP(=O)(O)O)nc2Br)c(Cl)c1 |
| InChI | InChI=1S/C11H11BrClN4O4P/c1-6-2-3-8(7(13)4-6)14-11(18)9-10(12)16-17(15-9)5-22(19,20)21/h2-4H,5H2,1H3,(H,14,18)(H2,19,20,21) |
| InChIKey | YADMNRBVJKPYLZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|