C11H9N3O2 — CID 154650491
N-(2-oxo-1-phenylpyrimidin-4-yl)formamide (PubChem CID 154650491) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is N-(2-oxo-1-phenylpyrimidin-4-yl)formamide.
| Compound Name | N-(2-oxo-1-phenylpyrimidin-4-yl)formamide |
|---|---|
| PubChem CID | 154650491 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-(2-oxo-1-phenylpyrimidin-4-yl)formamide |
| SMILES | O=CNc1ccn(-c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C11H9N3O2/c15-8-12-10-6-7-14(11(16)13-10)9-4-2-1-3-5-9/h1-8H,(H,12,13,15,16) |
| InChIKey | DIQZZUJZBWQNCY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|