C9H12FNO — CID 154656212
N-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]acetamide (PubChem CID 154656212) has the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. Its IUPAC name is N-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]acetamide.
| Compound Name | N-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]acetamide |
|---|---|
| PubChem CID | 154656212 |
| Molecular Formula | C9H12FNO |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-[(3Z)-5-fluoro-2-methylidenehexa-3,5-dienyl]acetamide |
| SMILES | C=C(F)/C=C\C(=C)CNC(C)=O |
| InChI | InChI=1S/C9H12FNO/c1-7(4-5-8(2)10)6-11-9(3)12/h4-5H,1-2,6H2,3H3,(H,11,12)/b5-4- |
| InChIKey | CKUHXTFPQAHWRF-PLNGDYQASA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|