C11H12F3NO — CID 10900465
2,2,2-trifluoro-N-[(2R,3E,5E)-2-methylocta-3,5-dien-7-ynyl]acetamide (PubChem CID 10900465) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R,3E,5E)-2-methylocta-3,5-dien-7-ynyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R,3E,5E)-2-methylocta-3,5-dien-7-ynyl]acetamide |
|---|---|
| PubChem CID | 10900465 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R,3E,5E)-2-methylocta-3,5-dien-7-ynyl]acetamide |
| SMILES | C#C/C=C/C=C/[C@@H](C)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO/c1-3-4-5-6-7-9(2)8-15-10(16)11(12,13)14/h1,4-7,9H,8H2,2H3,(H,15,16)/b5-4+,7-6+/t9-/m1/s1 |
| InChIKey | LNJLTNILQJOKRE-QLZAQQANSA-N |
| XLogP | 2.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|