C29H31N5O3 — CID 154660524
3-(3-aminopropanoylamino)-N-[(2S)-1-oxo-3-phenyl-1-(2-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propan-2-yl]benzamide (PubChem CID 154660524) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 3-(3-aminopropanoylamino)-N-[(2S)-1-oxo-3-phenyl-1-(2-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propan-2-yl]benzamide.
| Compound Name | 3-(3-aminopropanoylamino)-N-[(2S)-1-oxo-3-phenyl-1-(2-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 154660524 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 3-(3-aminopropanoylamino)-N-[(2S)-1-oxo-3-phenyl-1-(2-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propan-2-yl]benzamide |
| SMILES | NCCC(=O)Nc1cccc(C(=O)N[C@@H](Cc2ccccc2)C(=O)N2CC=CCC2c2cccnc2)c1 |
| InChI | InChI=1S/C29H31N5O3/c30-15-14-27(35)32-24-12-6-10-22(19-24)28(36)33-25(18-21-8-2-1-3-9-21)29(37)34-17-5-4-13-26(34)23-11-7-16-31-20-23/h1-12,16,19-20,25-26H,13-15,17-18,30H2,(H,32,35)(H,33,36)/t25-,26?/m0/s1 |
| InChIKey | FUIILTABOAUYTD-PMCHYTPCSA-N |
| XLogP | 3.24 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|