C28H30N4O3 — CID 162371146
3-(butanoylamino)-N-[1-oxo-1-(2-quinolin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propan-2-yl]benzamide (PubChem CID 162371146) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-(butanoylamino)-N-[1-oxo-1-(2-quinolin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propan-2-yl]benzamide.
| Compound Name | 3-(butanoylamino)-N-[1-oxo-1-(2-quinolin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 162371146 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 3-(butanoylamino)-N-[1-oxo-1-(2-quinolin-3-yl-3,6-dihydro-2H-pyridin-1-yl)propan-2-yl]benzamide |
| SMILES | CCCC(=O)Nc1cccc(C(=O)NC(C)C(=O)N2CC=CCC2c2cnc3ccccc3c2)c1 |
| InChI | InChI=1S/C28H30N4O3/c1-3-9-26(33)31-23-12-8-11-21(17-23)27(34)30-19(2)28(35)32-15-7-6-14-25(32)22-16-20-10-4-5-13-24(20)29-18-22/h4-8,10-13,16-19,25H,3,9,14-15H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | FKBYPSFOHWGHIL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|