C35H35N3O3 — CID 163817110
N-[3-[(3R)-3-(naphthalen-2-ylmethyl)-4-oxo-4-(2-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)butanoyl]phenyl]butanamide (PubChem CID 163817110) has the molecular formula C35H35N3O3 and a molecular weight of 545.68 g/mol. Its IUPAC name is N-[3-[(3R)-3-(naphthalen-2-ylmethyl)-4-oxo-4-(2-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)butanoyl]phenyl]butanamide.
| Compound Name | N-[3-[(3R)-3-(naphthalen-2-ylmethyl)-4-oxo-4-(2-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)butanoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 163817110 |
| Molecular Formula | C35H35N3O3 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | N-[3-[(3R)-3-(naphthalen-2-ylmethyl)-4-oxo-4-(2-pyridin-3-yl-3,6-dihydro-2H-pyridin-1-yl)butanoyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(C(=O)C[C@@H](Cc2ccc3ccccc3c2)C(=O)N2CC=CCC2c2cccnc2)c1 |
| InChI | InChI=1S/C35H35N3O3/c1-2-9-34(40)37-31-14-7-12-28(22-31)33(39)23-30(21-25-16-17-26-10-3-4-11-27(26)20-25)35(41)38-19-6-5-15-32(38)29-13-8-18-36-24-29/h3-8,10-14,16-18,20,22,24,30,32H,2,9,15,19,21,23H2,1H3,(H,37,40)/t30-,32?/m1/s1 |
| InChIKey | NSHIJNDLWRBTFR-VETVTEPKSA-N |
| XLogP | 6.93 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|