C20H28FN5O2S2 — CID 154662070
2-(5-aminosulfanyl-1,3-thiazol-2-yl)propan-2-ol;[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]urea (PubChem CID 154662070) has the molecular formula C20H28FN5O2S2 and a molecular weight of 453.61 g/mol. Its IUPAC name is 2-(5-aminosulfanyl-1,3-thiazol-2-yl)propan-2-ol;[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 2-(5-aminosulfanyl-1,3-thiazol-2-yl)propan-2-ol;[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 154662070 |
| Molecular Formula | C20H28FN5O2S2 |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 2-(5-aminosulfanyl-1,3-thiazol-2-yl)propan-2-ol;[4-cyano-3-fluoro-2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)(O)c1ncc(SN)s1.CC(C)c1cc(C#N)c(F)c(C(C)C)c1NC(N)=O |
| InChI | InChI=1S/C14H18FN3O.C6H10N2OS2/c1-7(2)10-5-9(6-16)12(15)11(8(3)4)13(10)18-14(17)19;1-6(2,9)5-8-3-4(10-5)11-7/h5,7-8H,1-4H3,(H3,17,18,19);3,9H,7H2,1-2H3 |
| InChIKey | VSNMJGJRJHFQIX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|