About 3-oxoprop-1-en-2-ylazanide;bis(yttrium)
3-oxoprop-1-en-2-ylazanide;bis(yttrium) (PubChem CID 154662182) has the molecular formula C3H3NOY2-2
and a molecular weight of 246.88 g/mol. Its IUPAC name is 3-oxoprop-1-en-2-ylazanide;bis(yttrium).
Molecular Properties
| Compound Name | 3-oxoprop-1-en-2-ylazanide;bis(yttrium) |
| PubChem CID | 154662182 |
| Molecular Formula | C3H3NOY2-2 |
| Molecular Weight | 246.88 g/mol |
| Exact Mass | 246.83 |
| IUPAC Name | 3-oxoprop-1-en-2-ylazanide;bis(yttrium) |
| SMILES | C=C([NH-])[C-]=O.[Y].[Y] |
| InChI | InChI=1S/C3H3NO.2Y/c1-3(4)2-5;;/h4H,1H2;;/q-2;; |
| InChIKey | WYRFYCFLABLHMQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.88 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-oxoprop-1-en-2-ylazanide;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxoprop-1-en-2-ylazanide;bis(yttrium)?
The IUPAC name of 3-oxoprop-1-en-2-ylazanide;bis(yttrium) (CID 154662182) is 3-oxoprop-1-en-2-ylazanide;bis(yttrium).
What is the SMILES notation for 3-oxoprop-1-en-2-ylazanide;bis(yttrium)?
The canonical SMILES for 3-oxoprop-1-en-2-ylazanide;bis(yttrium) is C=C([NH-])[C-]=O.[Y].[Y].
What is the InChIKey of 3-oxoprop-1-en-2-ylazanide;bis(yttrium)?
The InChIKey is WYRFYCFLABLHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3NO.2Y/c1-3(4)2-5;;/h4H,1H2;;/q-2;;.
What are the key properties of 3-oxoprop-1-en-2-ylazanide;bis(yttrium)?
3-oxoprop-1-en-2-ylazanide;bis(yttrium) has a molecular weight of 246.88 g/mol, XLogP of 0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxoprop-1-en-2-ylazanide;bis(yttrium) is sourced from PubChem (CID 154662182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).