About 2-methylprop-2-en-1-one;yttrium(3+)
2-methylprop-2-en-1-one;yttrium(3+) (PubChem CID 18722147) has the molecular formula C4H5OY+2
and a molecular weight of 157.99 g/mol. Its IUPAC name is 2-methylprop-2-en-1-one;yttrium(3+).
Molecular Properties
| Compound Name | 2-methylprop-2-en-1-one;yttrium(3+) |
| PubChem CID | 18722147 |
| Molecular Formula | C4H5OY+2 |
| Molecular Weight | 157.99 g/mol |
| Exact Mass | 157.94 |
| IUPAC Name | 2-methylprop-2-en-1-one;yttrium(3+) |
| SMILES | C=C(C)[C-]=O.[Y+3] |
| InChI | InChI=1S/C4H5O.Y/c1-4(2)3-5;/h1H2,2H3;/q-1;+3 |
| InChIKey | RJDWMHHYTJNVFK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.99 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-en-1-one;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-en-1-one;yttrium(3+)?
The IUPAC name of 2-methylprop-2-en-1-one;yttrium(3+) (CID 18722147) is 2-methylprop-2-en-1-one;yttrium(3+).
What is the SMILES notation for 2-methylprop-2-en-1-one;yttrium(3+)?
The canonical SMILES for 2-methylprop-2-en-1-one;yttrium(3+) is C=C(C)[C-]=O.[Y+3].
What is the InChIKey of 2-methylprop-2-en-1-one;yttrium(3+)?
The InChIKey is RJDWMHHYTJNVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5O.Y/c1-4(2)3-5;/h1H2,2H3;/q-1;+3.
What are the key properties of 2-methylprop-2-en-1-one;yttrium(3+)?
2-methylprop-2-en-1-one;yttrium(3+) has a molecular weight of 157.99 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-en-1-one;yttrium(3+) is sourced from PubChem (CID 18722147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).