About 2-methylidenebutane-1,3-dione;bis(yttrium)
2-methylidenebutane-1,3-dione;bis(yttrium) (PubChem CID 59648874) has the molecular formula C5H5O2Y2-
and a molecular weight of 274.91 g/mol. Its IUPAC name is 2-methylidenebutane-1,3-dione;bis(yttrium).
Molecular Properties
| Compound Name | 2-methylidenebutane-1,3-dione;bis(yttrium) |
| PubChem CID | 59648874 |
| Molecular Formula | C5H5O2Y2- |
| Molecular Weight | 274.91 g/mol |
| Exact Mass | 274.84 |
| IUPAC Name | 2-methylidenebutane-1,3-dione;bis(yttrium) |
| SMILES | C=C([C-]=O)C(C)=O.[Y].[Y] |
| InChI | InChI=1S/C5H5O2.2Y/c1-4(3-6)5(2)7;;/h1H2,2H3;;/q-1;; |
| InChIKey | DGZLOQYNTDCXQG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.91 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutane-1,3-dione;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutane-1,3-dione;bis(yttrium)?
The IUPAC name of 2-methylidenebutane-1,3-dione;bis(yttrium) (CID 59648874) is 2-methylidenebutane-1,3-dione;bis(yttrium).
What is the SMILES notation for 2-methylidenebutane-1,3-dione;bis(yttrium)?
The canonical SMILES for 2-methylidenebutane-1,3-dione;bis(yttrium) is C=C([C-]=O)C(C)=O.[Y].[Y].
What is the InChIKey of 2-methylidenebutane-1,3-dione;bis(yttrium)?
The InChIKey is DGZLOQYNTDCXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5O2.2Y/c1-4(3-6)5(2)7;;/h1H2,2H3;;/q-1;;.
What are the key properties of 2-methylidenebutane-1,3-dione;bis(yttrium)?
2-methylidenebutane-1,3-dione;bis(yttrium) has a molecular weight of 274.91 g/mol, XLogP of 0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutane-1,3-dione;bis(yttrium) is sourced from PubChem (CID 59648874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).