About 2-methylprop-2-en-1-one;tantalum
2-methylprop-2-en-1-one;tantalum (PubChem CID 87346004) has the molecular formula C4H5OTa-
and a molecular weight of 250.03 g/mol. Its IUPAC name is 2-methylprop-2-en-1-one;tantalum.
Molecular Properties
| Compound Name | 2-methylprop-2-en-1-one;tantalum |
| PubChem CID | 87346004 |
| Molecular Formula | C4H5OTa- |
| Molecular Weight | 250.03 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 2-methylprop-2-en-1-one;tantalum |
| SMILES | C=C(C)[C-]=O.[Ta] |
| InChI | InChI=1S/C4H5O.Ta/c1-4(2)3-5;/h1H2,2H3;/q-1; |
| InChIKey | QVKRCPMAKUYVFZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.03 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-en-1-one;tantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-en-1-one;tantalum?
The IUPAC name of 2-methylprop-2-en-1-one;tantalum (CID 87346004) is 2-methylprop-2-en-1-one;tantalum.
What is the SMILES notation for 2-methylprop-2-en-1-one;tantalum?
The canonical SMILES for 2-methylprop-2-en-1-one;tantalum is C=C(C)[C-]=O.[Ta].
What is the InChIKey of 2-methylprop-2-en-1-one;tantalum?
The InChIKey is QVKRCPMAKUYVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5O.Ta/c1-4(2)3-5;/h1H2,2H3;/q-1;.
What are the key properties of 2-methylprop-2-en-1-one;tantalum?
2-methylprop-2-en-1-one;tantalum has a molecular weight of 250.03 g/mol, XLogP of 0.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-en-1-one;tantalum is sourced from PubChem (CID 87346004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).