C11H14F2N2O3 — CID 154664795
methyl 2-amino-6-(3,3-difluorobutoxy)pyridine-3-carboxylate (PubChem CID 154664795) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is methyl 2-amino-6-(3,3-difluorobutoxy)pyridine-3-carboxylate.
| Compound Name | methyl 2-amino-6-(3,3-difluorobutoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 154664795 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl 2-amino-6-(3,3-difluorobutoxy)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(OCCC(C)(F)F)nc1N |
| InChI | InChI=1S/C11H14F2N2O3/c1-11(12,13)5-6-18-8-4-3-7(9(14)15-8)10(16)17-2/h3-4H,5-6H2,1-2H3,(H2,14,15) |
| InChIKey | AALILGGRHOTAMT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |