C9H11N3O3 — CID 156808956
methyl 2-amino-6-(formamidomethyl)pyridine-3-carboxylate (PubChem CID 156808956) has the molecular formula C9H11N3O3 and a molecular weight of 209.21 g/mol. Its IUPAC name is methyl 2-amino-6-(formamidomethyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-amino-6-(formamidomethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 156808956 |
| Molecular Formula | C9H11N3O3 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | methyl 2-amino-6-(formamidomethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNC=O)nc1N |
| InChI | InChI=1S/C9H11N3O3/c1-15-9(14)7-3-2-6(4-11-5-13)12-8(7)10/h2-3,5H,4H2,1H3,(H2,10,12)(H,11,13) |
| InChIKey | FGFDLBUGYGWQFU-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|