About methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate
methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate (PubChem CID 162607042) has the molecular formula C11H12F2N2O3
and a molecular weight of 258.22 g/mol. Its IUPAC name is methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate |
| PubChem CID | 162607042 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate |
| SMILES | C=CC(F)(F)COc1ccc(C(=O)OC)c(N)n1 |
| InChI | InChI=1S/C11H12F2N2O3/c1-3-11(12,13)6-18-8-5-4-7(9(14)15-8)10(16)17-2/h3-5H,1,6H2,2H3,(H2,14,15) |
| InChIKey | OAWSWPFWVUVAGL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate?
The IUPAC name of methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate (CID 162607042) is methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate?
The canonical SMILES for methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate is C=CC(F)(F)COc1ccc(C(=O)OC)c(N)n1.
What is the InChIKey of methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate?
The InChIKey is OAWSWPFWVUVAGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2N2O3/c1-3-11(12,13)6-18-8-5-4-7(9(14)15-8)10(16)17-2/h3-5H,1,6H2,2H3,(H2,14,15).
What are the key properties of methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate?
methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate has a molecular weight of 258.22 g/mol, XLogP of 1.65, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate is sourced from PubChem (CID 162607042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).