C11H12F2N2O3 — CID 162607042
methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate (PubChem CID 162607042) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate.
| Compound Name | methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 162607042 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | methyl 2-amino-6-(2,2-difluorobut-3-enoxy)pyridine-3-carboxylate |
| SMILES | C=CC(F)(F)COc1ccc(C(=O)OC)c(N)n1 |
| InChI | InChI=1S/C11H12F2N2O3/c1-3-11(12,13)6-18-8-5-4-7(9(14)15-8)10(16)17-2/h3-5H,1,6H2,2H3,(H2,14,15) |
| InChIKey | OAWSWPFWVUVAGL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|