C16H19FN4O2S — CID 154666874
tert-butyl N-[2-[[4-(6-fluoro-2-pyridinyl)-1,3-thiazol-2-yl]amino]prop-2-enyl]carbamate (PubChem CID 154666874) has the molecular formula C16H19FN4O2S and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-(6-fluoro-2-pyridinyl)-1,3-thiazol-2-yl]amino]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-(6-fluoro-2-pyridinyl)-1,3-thiazol-2-yl]amino]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 154666874 |
| Molecular Formula | C16H19FN4O2S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | tert-butyl N-[2-[[4-(6-fluoro-2-pyridinyl)-1,3-thiazol-2-yl]amino]prop-2-enyl]carbamate |
| SMILES | C=C(CNC(=O)OC(C)(C)C)Nc1nc(-c2cccc(F)n2)cs1 |
| InChI | InChI=1S/C16H19FN4O2S/c1-10(8-18-15(22)23-16(2,3)4)19-14-21-12(9-24-14)11-6-5-7-13(17)20-11/h5-7,9H,1,8H2,2-4H3,(H,18,22)(H,19,21) |
| InChIKey | XRISHUUQLBPZLZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|