C24H24F5N5O2 — CID 154667187
2-(2,2-difluoroethyl)-7-[6-[(3S)-3-(trifluoromethyl)piperidine-1-carbonyl]naphthalen-1-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 154667187) has the molecular formula C24H24F5N5O2 and a molecular weight of 509.48 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-7-[6-[(3S)-3-(trifluoromethyl)piperidine-1-carbonyl]naphthalen-1-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(2,2-difluoroethyl)-7-[6-[(3S)-3-(trifluoromethyl)piperidine-1-carbonyl]naphthalen-1-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 154667187 |
| Molecular Formula | C24H24F5N5O2 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 2-(2,2-difluoroethyl)-7-[6-[(3S)-3-(trifluoromethyl)piperidine-1-carbonyl]naphthalen-1-yl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | O=C(c1ccc2c(N3CCn4c(nn(CC(F)F)c4=O)C3)cccc2c1)N1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C24H24F5N5O2/c25-20(26)13-34-23(36)33-10-9-31(14-21(33)30-34)19-5-1-3-15-11-16(6-7-18(15)19)22(35)32-8-2-4-17(12-32)24(27,28)29/h1,3,5-7,11,17,20H,2,4,8-10,12-14H2/t17-/m0/s1 |
| InChIKey | REGSHMVUCVQUKU-KRWDZBQOSA-N |
| XLogP | 3.90 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |