C26H39N3O2 — CID 154670792
ethane;3-[3-methylidene-6-[3-methyl-3-(3-methylpentyl)azetidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154670792) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is ethane;3-[3-methylidene-6-[3-methyl-3-(3-methylpentyl)azetidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[3-methylidene-6-[3-methyl-3-(3-methylpentyl)azetidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154670792 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | ethane;3-[3-methylidene-6-[3-methyl-3-(3-methylpentyl)azetidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=C1c2ccc(N3CC(C)(CCC(C)CC)C3)cc2CN1C1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C24H33N3O2.C2H6/c1-5-16(2)10-11-24(4)14-26(15-24)19-6-7-20-17(3)27(13-18(20)12-19)21-8-9-22(28)25-23(21)29;1-2/h6-7,12,16,21H,3,5,8-11,13-15H2,1-2,4H3,(H,25,28,29);1-2H3 |
| InChIKey | ISJBJPUNTHBQLY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|