C7H15O2PS2 — CID 15467107
2-butylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane (PubChem CID 15467107) has the molecular formula C7H15O2PS2 and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-butylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane.
| Compound Name | 2-butylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
|---|---|
| PubChem CID | 15467107 |
| Molecular Formula | C7H15O2PS2 |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 2-butylsulfanyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinane |
| SMILES | CCCCSP1(=S)OCCCO1 |
| InChI | InChI=1S/C7H15O2PS2/c1-2-3-7-12-10(11)8-5-4-6-9-10/h2-7H2,1H3 |
| InChIKey | VVWFOWBKVJSKOR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|