C13H12N4O2S — CID 154673895
1-methyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine (PubChem CID 154673895) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 1-methyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine.
| Compound Name | 1-methyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine |
|---|---|
| PubChem CID | 154673895 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-methyl-4-(4-methylphenyl)sulfonylpyrazolo[5,4-c]pyridazine |
| SMILES | Cc1ccc(S(=O)(=O)c2cnnc3c2cnn3C)cc1 |
| InChI | InChI=1S/C13H12N4O2S/c1-9-3-5-10(6-4-9)20(18,19)12-8-14-16-13-11(12)7-15-17(13)2/h3-8H,1-2H3 |
| InChIKey | PWDQUABVKDUEDZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |