C23H19ClF4N4O3 — CID 154674837
2-(2-chloro-6-fluorophenyl)-6-[4-ethyl-3-(hydroxymethyl)-5-oxo-1,2,4-triazol-1-yl]-4-(3,3,3-trifluoroprop-1-en-2-yl)-3,4-dihydroisoquinolin-1-one (PubChem CID 154674837) has the molecular formula C23H19ClF4N4O3 and a molecular weight of 510.88 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-6-[4-ethyl-3-(hydroxymethyl)-5-oxo-1,2,4-triazol-1-yl]-4-(3,3,3-trifluoroprop-1-en-2-yl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-6-[4-ethyl-3-(hydroxymethyl)-5-oxo-1,2,4-triazol-1-yl]-4-(3,3,3-trifluoroprop-1-en-2-yl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 154674837 |
| Molecular Formula | C23H19ClF4N4O3 |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-6-[4-ethyl-3-(hydroxymethyl)-5-oxo-1,2,4-triazol-1-yl]-4-(3,3,3-trifluoroprop-1-en-2-yl)-3,4-dihydroisoquinolin-1-one |
| SMILES | C=C(C1CN(c2c(F)cccc2Cl)C(=O)c2ccc(-n3nc(CO)n(CC)c3=O)cc21)C(F)(F)F |
| InChI | InChI=1S/C23H19ClF4N4O3/c1-3-30-19(11-33)29-32(22(30)35)13-7-8-14-15(9-13)16(12(2)23(26,27)28)10-31(21(14)34)20-17(24)5-4-6-18(20)25/h4-9,16,33H,2-3,10-11H2,1H3 |
| InChIKey | DVPKHXNAMLAXOO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|