C39H40F2N4O3Si — CID 175361697
6-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethyl-5-oxo-1,2,4-triazol-1-yl]-2-(2,6-difluorophenyl)-4-prop-1-en-2-yl-3,4-dihydroisoquinolin-1-one (PubChem CID 175361697) has the molecular formula C39H40F2N4O3Si and a molecular weight of 678.86 g/mol. Its IUPAC name is 6-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethyl-5-oxo-1,2,4-triazol-1-yl]-2-(2,6-difluorophenyl)-4-prop-1-en-2-yl-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethyl-5-oxo-1,2,4-triazol-1-yl]-2-(2,6-difluorophenyl)-4-prop-1-en-2-yl-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 175361697 |
| Molecular Formula | C39H40F2N4O3Si |
| Molecular Weight | 678.86 g/mol |
| Exact Mass | 678.28 |
| IUPAC Name | 6-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethyl-5-oxo-1,2,4-triazol-1-yl]-2-(2,6-difluorophenyl)-4-prop-1-en-2-yl-3,4-dihydroisoquinolin-1-one |
| SMILES | C=C(C)C1CN(c2c(F)cccc2F)C(=O)c2ccc(-n3nc(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)n(CC)c3=O)cc21 |
| InChI | InChI=1S/C39H40F2N4O3Si/c1-7-43-35(25-48-49(39(4,5)6,28-15-10-8-11-16-28)29-17-12-9-13-18-29)42-45(38(43)47)27-21-22-30-31(23-27)32(26(2)3)24-44(37(30)46)36-33(40)19-14-20-34(36)41/h8-23,32H,2,7,24-25H2,1,3-6H3 |
| InChIKey | SAJZGKVFSYYQHY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.86 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|