C42H39FN4O3Si — CID 175708569
3-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethyl-5-oxo-1,2,4-triazol-1-yl]-2-(3-fluorophenyl)-4-phenylisoquinolin-1-one (PubChem CID 175708569) has the molecular formula C42H39FN4O3Si and a molecular weight of 694.88 g/mol. Its IUPAC name is 3-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethyl-5-oxo-1,2,4-triazol-1-yl]-2-(3-fluorophenyl)-4-phenylisoquinolin-1-one.
| Compound Name | 3-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethyl-5-oxo-1,2,4-triazol-1-yl]-2-(3-fluorophenyl)-4-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 175708569 |
| Molecular Formula | C42H39FN4O3Si |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 3-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethyl-5-oxo-1,2,4-triazol-1-yl]-2-(3-fluorophenyl)-4-phenylisoquinolin-1-one |
| SMILES | CCn1c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)nn(-c2c(-c3ccccc3)c3ccccc3c(=O)n2-c2cccc(F)c2)c1=O |
| InChI | InChI=1S/C42H39FN4O3Si/c1-5-45-37(29-50-51(42(2,3)4,33-22-11-7-12-23-33)34-24-13-8-14-25-34)44-47(41(45)49)39-38(30-18-9-6-10-19-30)35-26-15-16-27-36(35)40(48)46(39)32-21-17-20-31(43)28-32/h6-28H,5,29H2,1-4H3 |
| InChIKey | OSBVGLNTXDWDNP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|