C27H34N2O2Si — CID 154408419
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethyl-5,6,7,8-tetrahydrocyclohepta[d]imidazol-4-one (PubChem CID 154408419) has the molecular formula C27H34N2O2Si and a molecular weight of 446.67 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethyl-5,6,7,8-tetrahydrocyclohepta[d]imidazol-4-one.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethyl-5,6,7,8-tetrahydrocyclohepta[d]imidazol-4-one |
|---|---|
| PubChem CID | 154408419 |
| Molecular Formula | C27H34N2O2Si |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethyl-5,6,7,8-tetrahydrocyclohepta[d]imidazol-4-one |
| SMILES | CCn1c(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)nc2c1CCCCC2=O |
| InChI | InChI=1S/C27H34N2O2Si/c1-5-29-23-18-12-13-19-24(30)26(23)28-25(29)20-31-32(27(2,3)4,21-14-8-6-9-15-21)22-16-10-7-11-17-22/h6-11,14-17H,5,12-13,18-20H2,1-4H3 |
| InChIKey | RYQIHAWFABNRGB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|