C21H29N3OSi — CID 164522217
tert-butyl-[(4-ethyl-1,5-dihydro-1,2,4-triazol-3-yl)methoxy]-diphenylsilane (PubChem CID 164522217) has the molecular formula C21H29N3OSi and a molecular weight of 367.57 g/mol. Its IUPAC name is tert-butyl-[(4-ethyl-1,5-dihydro-1,2,4-triazol-3-yl)methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4-ethyl-1,5-dihydro-1,2,4-triazol-3-yl)methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 164522217 |
| Molecular Formula | C21H29N3OSi |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | tert-butyl-[(4-ethyl-1,5-dihydro-1,2,4-triazol-3-yl)methoxy]-diphenylsilane |
| SMILES | CCN1CNN=C1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C21H29N3OSi/c1-5-24-17-22-23-20(24)16-25-26(21(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,22H,5,16-17H2,1-4H3 |
| InChIKey | YEMVDTKSKZUNFS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|