C24H23ClF4N4O3 — CID 155056383
N-[(Z)-N-[[2-(2-chloro-6-fluorophenyl)-1-oxo-4-(3,3,3-trifluoroprop-1-en-2-yl)-3,4-dihydroisoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]-N-ethylformamide (PubChem CID 155056383) has the molecular formula C24H23ClF4N4O3 and a molecular weight of 526.92 g/mol. Its IUPAC name is N-[(Z)-N-[[2-(2-chloro-6-fluorophenyl)-1-oxo-4-(3,3,3-trifluoroprop-1-en-2-yl)-3,4-dihydroisoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]-N-ethylformamide.
| Compound Name | N-[(Z)-N-[[2-(2-chloro-6-fluorophenyl)-1-oxo-4-(3,3,3-trifluoroprop-1-en-2-yl)-3,4-dihydroisoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]-N-ethylformamide |
|---|---|
| PubChem CID | 155056383 |
| Molecular Formula | C24H23ClF4N4O3 |
| Molecular Weight | 526.92 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[(Z)-N-[[2-(2-chloro-6-fluorophenyl)-1-oxo-4-(3,3,3-trifluoroprop-1-en-2-yl)-3,4-dihydroisoquinolin-6-yl]-methylamino]-C-(hydroxymethyl)carbonimidoyl]-N-ethylformamide |
| SMILES | C=C(C1CN(c2c(F)cccc2Cl)C(=O)c2ccc(N(C)/N=C(/CO)N(C=O)CC)cc21)C(F)(F)F |
| InChI | InChI=1S/C24H23ClF4N4O3/c1-4-32(13-35)21(12-34)30-31(3)15-8-9-16-17(10-15)18(14(2)24(27,28)29)11-33(23(16)36)22-19(25)6-5-7-20(22)26/h5-10,13,18,34H,2,4,11-12H2,1,3H3/b30-21- |
| InChIKey | XRNDBGSNIUCQJB-OFWBYEQRSA-N |
| XLogP | 4.56 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|