C21H28N4O3 — CID 154677450
tert-butyl (NE)-N-[3-(4-cyanophenyl)-1-(4-methylpiperazin-1-yl)-1-oxobutan-2-ylidene]carbamate (PubChem CID 154677450) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl (NE)-N-[3-(4-cyanophenyl)-1-(4-methylpiperazin-1-yl)-1-oxobutan-2-ylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[3-(4-cyanophenyl)-1-(4-methylpiperazin-1-yl)-1-oxobutan-2-ylidene]carbamate |
|---|---|
| PubChem CID | 154677450 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | tert-butyl (NE)-N-[3-(4-cyanophenyl)-1-(4-methylpiperazin-1-yl)-1-oxobutan-2-ylidene]carbamate |
| SMILES | CC(/C(=N\C(=O)OC(C)(C)C)C(=O)N1CCN(C)CC1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H28N4O3/c1-15(17-8-6-16(14-22)7-9-17)18(23-20(27)28-21(2,3)4)19(26)25-12-10-24(5)11-13-25/h6-9,15H,10-13H2,1-5H3/b23-18+ |
| InChIKey | SUSUHLLNHFXBJP-PTGBLXJZSA-N |
| XLogP | 2.81 |
| TPSA | 86.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|