C21H26F3N3O2S3 — CID 154678895
CID 154678895 (PubChem CID 154678895) has the molecular formula C21H26F3N3O2S3 and a molecular weight of 505.65 g/mol.
| Compound Name | CID 154678895 |
|---|---|
| PubChem CID | 154678895 |
| Molecular Formula | C21H26F3N3O2S3 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | — |
| SMILES | N[S-](#[O+])c1ccc(N[C@H](CCN2CCOCC2)CSc2ccccc2)c(SC(F)(F)F)c1 |
| InChI | InChI=1S/C21H26F3N3O2S3/c22-21(23,24)31-20-14-18(32(25)28)6-7-19(20)26-16(8-9-27-10-12-29-13-11-27)15-30-17-4-2-1-3-5-17/h1-7,14,16,26H,8-13,15,25H2/t16-/m1/s1 |
| InChIKey | AMDZRURQNNKYIH-MRXNPFEDSA-N |
| XLogP | 4.79 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|