C13H16N5O2+ — CID 154679190
(2S)-2-(methylamino)-4-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)butanoic acid (PubChem CID 154679190) has the molecular formula C13H16N5O2+ and a molecular weight of 274.30 g/mol. Its IUPAC name is (2S)-2-(methylamino)-4-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)butanoic acid.
| Compound Name | (2S)-2-(methylamino)-4-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)butanoic acid |
|---|---|
| PubChem CID | 154679190 |
| Molecular Formula | C13H16N5O2+ |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (2S)-2-(methylamino)-4-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)butanoic acid |
| SMILES | CN[C@@H](CC[n+]1ccc(-c2ncccn2)cn1)C(=O)O |
| InChI | InChI=1S/C13H15N5O2/c1-14-11(13(19)20)4-8-18-7-3-10(9-17-18)12-15-5-2-6-16-12/h2-3,5-7,9,11,14H,4,8H2,1H3/p+1/t11-/m0/s1 |
| InChIKey | IKJCCIJJYZYUJS-NSHDSACASA-O |
| XLogP | -0.11 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|