C11H9N2O4+ — CID 154679294
2-(carboxymethyl)cinnolin-2-ium-4-carboxylic acid (PubChem CID 154679294) has the molecular formula C11H9N2O4+ and a molecular weight of 233.20 g/mol. Its IUPAC name is 2-(carboxymethyl)cinnolin-2-ium-4-carboxylic acid.
| Compound Name | 2-(carboxymethyl)cinnolin-2-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 154679294 |
| Molecular Formula | C11H9N2O4+ |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-(carboxymethyl)cinnolin-2-ium-4-carboxylic acid |
| SMILES | O=C(O)C[n+]1cc(C(=O)O)c2ccccc2n1 |
| InChI | InChI=1S/C11H8N2O4/c14-10(15)6-13-5-8(11(16)17)7-3-1-2-4-9(7)12-13/h1-5H,6H2,(H-,14,15,16,17)/p+1 |
| InChIKey | WILIHSQKKJMWLT-UHFFFAOYSA-O |
| XLogP | 0.31 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|