C13H14N4O6S2 — CID 165094813
2-[2-(methanesulfonamido)-2-oxoethyl]-N-methylsulfonylcinnolin-2-ium-4-carboximidate (PubChem CID 165094813) has the molecular formula C13H14N4O6S2 and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-[2-(methanesulfonamido)-2-oxoethyl]-N-methylsulfonylcinnolin-2-ium-4-carboximidate.
| Compound Name | 2-[2-(methanesulfonamido)-2-oxoethyl]-N-methylsulfonylcinnolin-2-ium-4-carboximidate |
|---|---|
| PubChem CID | 165094813 |
| Molecular Formula | C13H14N4O6S2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-[2-(methanesulfonamido)-2-oxoethyl]-N-methylsulfonylcinnolin-2-ium-4-carboximidate |
| SMILES | CS(=O)(=O)N=C([O-])c1c[n+](CC(=O)NS(C)(=O)=O)nc2ccccc12 |
| InChI | InChI=1S/C13H14N4O6S2/c1-24(20,21)15-12(18)8-17-7-10(13(19)16-25(2,22)23)9-5-3-4-6-11(9)14-17/h3-7H,8H2,1-2H3,(H-,15,16,18,19) |
| InChIKey | XHVDXOAEHVEPFC-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|