C12H12F2N3O3S+ — CID 154679284
2-(2,2-difluoroethyl)-N-methylsulfonylcinnolin-2-ium-4-carboxamide (PubChem CID 154679284) has the molecular formula C12H12F2N3O3S+ and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-N-methylsulfonylcinnolin-2-ium-4-carboxamide.
| Compound Name | 2-(2,2-difluoroethyl)-N-methylsulfonylcinnolin-2-ium-4-carboxamide |
|---|---|
| PubChem CID | 154679284 |
| Molecular Formula | C12H12F2N3O3S+ |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-(2,2-difluoroethyl)-N-methylsulfonylcinnolin-2-ium-4-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1c[n+](CC(F)F)nc2ccccc12 |
| InChI | InChI=1S/C12H11F2N3O3S/c1-21(19,20)16-12(18)9-6-17(7-11(13)14)15-10-5-3-2-4-8(9)10/h2-6,11H,7H2,1H3/p+1 |
| InChIKey | JTBIJLKVOKYRJJ-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|