C9H15LrN2- — CID 154679319
lawrencium;N'-[(3Z)-2-methylhepta-3,5-dien-3-yl]methanimidamide (PubChem CID 154679319) has the molecular formula C9H15LrN2- and a molecular weight of 413.23 g/mol. Its IUPAC name is lawrencium;N'-[(3Z)-2-methylhepta-3,5-dien-3-yl]methanimidamide.
| Compound Name | lawrencium;N'-[(3Z)-2-methylhepta-3,5-dien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 154679319 |
| Molecular Formula | C9H15LrN2- |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | lawrencium;N'-[(3Z)-2-methylhepta-3,5-dien-3-yl]methanimidamide |
| SMILES | C/[C-]=C\C=C(/N=C/N)C(C)C.[Lr] |
| InChI | InChI=1S/C9H15N2.Lr/c1-4-5-6-9(8(2)3)11-7-10;/h5-8H,1-3H3,(H2,10,11);/q-1;/b9-6-; |
| InChIKey | SVEYZCPBVVKVIZ-BORNJIKYSA-N |
| XLogP | 1.89 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|