About ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne
ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne (PubChem CID 154679362) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne.
Molecular Properties
| Compound Name | ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne |
| PubChem CID | 154679362 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne |
| SMILES | C#CC.C/C=C\C(C)=N\C.CC |
| InChI | InChI=1S/C6H11N.C3H4.C2H6/c1-4-5-6(2)7-3;1-3-2;1-2/h4-5H,1-3H3;1H,2H3;1-2H3/b5-4-,7-6+;; |
| InChIKey | NPSQZUHIMYPJNP-NBTOHIFCSA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne?
The IUPAC name of ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne (CID 154679362) is ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne.
What is the SMILES notation for ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne?
The canonical SMILES for ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne is C#CC.C/C=C\C(C)=N\C.CC.
What is the InChIKey of ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne?
The InChIKey is NPSQZUHIMYPJNP-NBTOHIFCSA-N. The full InChI is InChI=1S/C6H11N.C3H4.C2H6/c1-4-5-6(2)7-3;1-3-2;1-2/h4-5H,1-3H3;1H,2H3;1-2H3/b5-4-,7-6+;;.
What are the key properties of ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne?
ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne has a molecular weight of 167.30 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-N-methylpent-3-en-2-imine;prop-1-yne is sourced from PubChem (CID 154679362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).