C23H25FN4O4 — CID 154679540
(Z)-4-amino-1-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-4-[4-(azetidine-1-carbonyl)phenyl]-1-iminobut-3-en-2-one (PubChem CID 154679540) has the molecular formula C23H25FN4O4 and a molecular weight of 440.48 g/mol. Its IUPAC name is (Z)-4-amino-1-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-4-[4-(azetidine-1-carbonyl)phenyl]-1-iminobut-3-en-2-one.
| Compound Name | (Z)-4-amino-1-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-4-[4-(azetidine-1-carbonyl)phenyl]-1-iminobut-3-en-2-one |
|---|---|
| PubChem CID | 154679540 |
| Molecular Formula | C23H25FN4O4 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (Z)-4-amino-1-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-4-[4-(azetidine-1-carbonyl)phenyl]-1-iminobut-3-en-2-one |
| SMILES | [H]/N=C(\C(=O)/C=C(\N)c1ccc(C(=O)N2CCC2)cc1)c1cc(F)c(OCCOC)cc1N |
| InChI | InChI=1S/C23H25FN4O4/c1-31-9-10-32-21-13-19(26)16(11-17(21)24)22(27)20(29)12-18(25)14-3-5-15(6-4-14)23(30)28-7-2-8-28/h3-6,11-13,27H,2,7-10,25-26H2,1H3/b18-12-,27-22- |
| InChIKey | HDXNBUAXHJLFBN-YATIHBHBSA-N |
| XLogP | 2.22 |
| TPSA | 131.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|