C21H27FN6O3 — CID 154679597
4-[amino-[(Z)-2-amino-3-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-3-iminoprop-1-enyl]amino]-N,N-dimethylbenzamide (PubChem CID 154679597) has the molecular formula C21H27FN6O3 and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-[amino-[(Z)-2-amino-3-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-3-iminoprop-1-enyl]amino]-N,N-dimethylbenzamide.
| Compound Name | 4-[amino-[(Z)-2-amino-3-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-3-iminoprop-1-enyl]amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 154679597 |
| Molecular Formula | C21H27FN6O3 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 4-[amino-[(Z)-2-amino-3-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-3-iminoprop-1-enyl]amino]-N,N-dimethylbenzamide |
| SMILES | [H]/N=C(C(\N)=C\N(N)c1ccc(C(=O)N(C)C)cc1)/c1cc(F)c(OCCOC)cc1N |
| InChI | InChI=1S/C21H27FN6O3/c1-27(2)21(29)13-4-6-14(7-5-13)28(26)12-18(24)20(25)15-10-16(22)19(11-17(15)23)31-9-8-30-3/h4-7,10-12,25H,8-9,23-24,26H2,1-3H3/b18-12-,25-20- |
| InChIKey | ASCAPKSHUGLIFP-NQMSZFHHSA-N |
| XLogP | 1.68 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|