C21H27FN4O5S — CID 154679847
ethane;ethyl 5-[(Z)-1-amino-4-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-4-imino-3-oxobut-1-enyl]-1,3-thiazole-2-carboxylate (PubChem CID 154679847) has the molecular formula C21H27FN4O5S and a molecular weight of 466.54 g/mol. Its IUPAC name is ethane;ethyl 5-[(Z)-1-amino-4-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-4-imino-3-oxobut-1-enyl]-1,3-thiazole-2-carboxylate.
| Compound Name | ethane;ethyl 5-[(Z)-1-amino-4-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-4-imino-3-oxobut-1-enyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 154679847 |
| Molecular Formula | C21H27FN4O5S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | ethane;ethyl 5-[(Z)-1-amino-4-[2-amino-5-fluoro-4-(2-methoxyethoxy)phenyl]-4-imino-3-oxobut-1-enyl]-1,3-thiazole-2-carboxylate |
| SMILES | CC.[H]/N=C(\C(=O)/C=C(\N)c1cnc(C(=O)OCC)s1)c1cc(F)c(OCCOC)cc1N |
| InChI | InChI=1S/C19H21FN4O5S.C2H6/c1-3-28-19(26)18-24-9-16(30-18)13(22)7-14(25)17(23)10-6-11(20)15(8-12(10)21)29-5-4-27-2;1-2/h6-9,23H,3-5,21-22H2,1-2H3;1-2H3/b13-7-,23-17-; |
| InChIKey | PYUWDNBXBAVUPW-GKLICJHASA-N |
| XLogP | 3.03 |
| TPSA | 150.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|