C30H41N2O2P — CID 154681628
N-ethyl-N-[[4-[2-(ethylamino)ethyl]phenyl]methyl]-3-methoxyaniline;5,6,7,8-tetrahydronaphthalen-2-yloxyphosphane (PubChem CID 154681628) has the molecular formula C30H41N2O2P and a molecular weight of 492.64 g/mol. Its IUPAC name is N-ethyl-N-[[4-[2-(ethylamino)ethyl]phenyl]methyl]-3-methoxyaniline;5,6,7,8-tetrahydronaphthalen-2-yloxyphosphane.
| Compound Name | N-ethyl-N-[[4-[2-(ethylamino)ethyl]phenyl]methyl]-3-methoxyaniline;5,6,7,8-tetrahydronaphthalen-2-yloxyphosphane |
|---|---|
| PubChem CID | 154681628 |
| Molecular Formula | C30H41N2O2P |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | N-ethyl-N-[[4-[2-(ethylamino)ethyl]phenyl]methyl]-3-methoxyaniline;5,6,7,8-tetrahydronaphthalen-2-yloxyphosphane |
| SMILES | CCNCCc1ccc(CN(CC)c2cccc(OC)c2)cc1.POc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H28N2O.C10H13OP/c1-4-21-14-13-17-9-11-18(12-10-17)16-22(5-2)19-7-6-8-20(15-19)23-3;12-11-10-6-5-8-3-1-2-4-9(8)7-10/h6-12,15,21H,4-5,13-14,16H2,1-3H3;5-7H,1-4,12H2 |
| InChIKey | MTZXRWRRQLRPTA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|