C12H19N3O3S2 — CID 154682525
tert-butyl N-[(3R,6S)-6-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)oxan-3-yl]carbamate (PubChem CID 154682525) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is tert-butyl N-[(3R,6S)-6-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,6S)-6-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 154682525 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | tert-butyl N-[(3R,6S)-6-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@@H](c2n[nH]c(=S)s2)OC1 |
| InChI | InChI=1S/C12H19N3O3S2/c1-12(2,3)18-10(16)13-7-4-5-8(17-6-7)9-14-15-11(19)20-9/h7-8H,4-6H2,1-3H3,(H,13,16)(H,15,19)/t7-,8+/m1/s1 |
| InChIKey | UWLCNHCMRJQXTE-SFYZADRCSA-N |
| XLogP | 2.95 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|