C10H10N2O2 — CID 154683547
3-(5-methoxy-1,2-oxazol-3-yl)aniline (PubChem CID 154683547) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-(5-methoxy-1,2-oxazol-3-yl)aniline.
| Compound Name | 3-(5-methoxy-1,2-oxazol-3-yl)aniline |
|---|---|
| PubChem CID | 154683547 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-(5-methoxy-1,2-oxazol-3-yl)aniline |
| SMILES | COc1cc(-c2cccc(N)c2)no1 |
| InChI | InChI=1S/C10H10N2O2/c1-13-10-6-9(12-14-10)7-3-2-4-8(11)5-7/h2-6H,11H2,1H3 |
| InChIKey | YQRLYAMMKAKJCQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|