C17H23BrFN3O — CID 154683636
3-bromo-N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoroaniline (PubChem CID 154683636) has the molecular formula C17H23BrFN3O and a molecular weight of 384.29 g/mol. Its IUPAC name is 3-bromo-N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoroaniline.
| Compound Name | 3-bromo-N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 154683636 |
| Molecular Formula | C17H23BrFN3O |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 3-bromo-N-[5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentyl]-4-fluoroaniline |
| SMILES | CC(C)(C)c1noc(CCCCCNc2ccc(F)c(Br)c2)n1 |
| InChI | InChI=1S/C17H23BrFN3O/c1-17(2,3)16-21-15(23-22-16)7-5-4-6-10-20-12-8-9-14(19)13(18)11-12/h8-9,11,20H,4-7,10H2,1-3H3 |
| InChIKey | DHUDBWODANGXFK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|